C23H28N4O5S — CID 91152794
ethyl 2-[5-[(4-acetamidophenyl)sulfonylamino]-2-tert-butylbenzimidazol-1-yl]acetate (PubChem CID 91152794) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is ethyl 2-[5-[(4-acetamidophenyl)sulfonylamino]-2-tert-butylbenzimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[5-[(4-acetamidophenyl)sulfonylamino]-2-tert-butylbenzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 91152794 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | ethyl 2-[5-[(4-acetamidophenyl)sulfonylamino]-2-tert-butylbenzimidazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C(C)(C)C)nc2cc(NS(=O)(=O)c3ccc(NC(C)=O)cc3)ccc21 |
| InChI | InChI=1S/C23H28N4O5S/c1-6-32-21(29)14-27-20-12-9-17(13-19(20)25-22(27)23(3,4)5)26-33(30,31)18-10-7-16(8-11-18)24-15(2)28/h7-13,26H,6,14H2,1-5H3,(H,24,28) |
| InChIKey | PEZFNVNCTZEWGY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |