C27H32N4O3S — CID 69260367
N-[4-[[1-[[(4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-tert-butylbenzimidazol-5-yl]sulfamoyl]phenyl]acetamide (PubChem CID 69260367) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is N-[4-[[1-[[(4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-tert-butylbenzimidazol-5-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[1-[[(4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-tert-butylbenzimidazol-5-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 69260367 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | N-[4-[[1-[[(4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-tert-butylbenzimidazol-5-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc3c(c2)nc(C(C)(C)C)n3CC2C[C@H]3C=CC2C3)cc1 |
| InChI | InChI=1S/C27H32N4O3S/c1-17(32)28-21-7-10-23(11-8-21)35(33,34)30-22-9-12-25-24(15-22)29-26(27(2,3)4)31(25)16-20-14-18-5-6-19(20)13-18/h5-12,15,18-20,30H,13-14,16H2,1-4H3,(H,28,32)/t18-,19?,20?/m0/s1 |
| InChIKey | GJTJYASFOWWLKX-HDYDNRTBSA-N |
| XLogP | 5.31 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|