C15H19N5O5S — CID 102512129
ethyl 2-[4-[[(4-acetamidophenyl)sulfonylamino]methyl]triazol-1-yl]acetate (PubChem CID 102512129) has the molecular formula C15H19N5O5S and a molecular weight of 381.41 g/mol. Its IUPAC name is ethyl 2-[4-[[(4-acetamidophenyl)sulfonylamino]methyl]triazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[[(4-acetamidophenyl)sulfonylamino]methyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 102512129 |
| Molecular Formula | C15H19N5O5S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | ethyl 2-[4-[[(4-acetamidophenyl)sulfonylamino]methyl]triazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(CNS(=O)(=O)c2ccc(NC(C)=O)cc2)nn1 |
| InChI | InChI=1S/C15H19N5O5S/c1-3-25-15(22)10-20-9-13(18-19-20)8-16-26(23,24)14-6-4-12(5-7-14)17-11(2)21/h4-7,9,16H,3,8,10H2,1-2H3,(H,17,21) |
| InChIKey | FNZBLGNLGBFFBE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |