C28H28IN5O5S — CID 169172065
ethyl 2-benzyl-3-[4-[[4-[[(4-iodophenyl)sulfonylamino]methyl]triazol-1-yl]methyl]anilino]-3-oxopropanoate (PubChem CID 169172065) has the molecular formula C28H28IN5O5S and a molecular weight of 673.53 g/mol. Its IUPAC name is ethyl 2-benzyl-3-[4-[[4-[[(4-iodophenyl)sulfonylamino]methyl]triazol-1-yl]methyl]anilino]-3-oxopropanoate.
| Compound Name | ethyl 2-benzyl-3-[4-[[4-[[(4-iodophenyl)sulfonylamino]methyl]triazol-1-yl]methyl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 169172065 |
| Molecular Formula | C28H28IN5O5S |
| Molecular Weight | 673.53 g/mol |
| Exact Mass | 673.09 |
| IUPAC Name | ethyl 2-benzyl-3-[4-[[4-[[(4-iodophenyl)sulfonylamino]methyl]triazol-1-yl]methyl]anilino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(=O)Nc1ccc(Cn2cc(CNS(=O)(=O)c3ccc(I)cc3)nn2)cc1 |
| InChI | InChI=1S/C28H28IN5O5S/c1-2-39-28(36)26(16-20-6-4-3-5-7-20)27(35)31-23-12-8-21(9-13-23)18-34-19-24(32-33-34)17-30-40(37,38)25-14-10-22(29)11-15-25/h3-15,19,26,30H,2,16-18H2,1H3,(H,31,35) |
| InChIKey | OGQJFJCPYZBXJG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|