C25H29ClN4O4 — CID 169172063
ethyl 2-[[4-[[4-[(4-chlorophenoxy)methyl]triazol-1-yl]methyl]phenyl]carbamoyl]-4-methylpentanoate (PubChem CID 169172063) has the molecular formula C25H29ClN4O4 and a molecular weight of 484.98 g/mol. Its IUPAC name is ethyl 2-[[4-[[4-[(4-chlorophenoxy)methyl]triazol-1-yl]methyl]phenyl]carbamoyl]-4-methylpentanoate.
| Compound Name | ethyl 2-[[4-[[4-[(4-chlorophenoxy)methyl]triazol-1-yl]methyl]phenyl]carbamoyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 169172063 |
| Molecular Formula | C25H29ClN4O4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | ethyl 2-[[4-[[4-[(4-chlorophenoxy)methyl]triazol-1-yl]methyl]phenyl]carbamoyl]-4-methylpentanoate |
| SMILES | CCOC(=O)C(CC(C)C)C(=O)Nc1ccc(Cn2cc(COc3ccc(Cl)cc3)nn2)cc1 |
| InChI | InChI=1S/C25H29ClN4O4/c1-4-33-25(32)23(13-17(2)3)24(31)27-20-9-5-18(6-10-20)14-30-15-21(28-29-30)16-34-22-11-7-19(26)8-12-22/h5-12,15,17,23H,4,13-14,16H2,1-3H3,(H,27,31) |
| InChIKey | JVEKEOAZJILETE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|