C16H25ClN2O3 — CID 174057394
ethyl 2-[[4-(aminomethyl)phenyl]carbamoyl]-4-methylpentanoate;hydrochloride (PubChem CID 174057394) has the molecular formula C16H25ClN2O3 and a molecular weight of 328.84 g/mol. Its IUPAC name is ethyl 2-[[4-(aminomethyl)phenyl]carbamoyl]-4-methylpentanoate;hydrochloride.
| Compound Name | ethyl 2-[[4-(aminomethyl)phenyl]carbamoyl]-4-methylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 174057394 |
| Molecular Formula | C16H25ClN2O3 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | ethyl 2-[[4-(aminomethyl)phenyl]carbamoyl]-4-methylpentanoate;hydrochloride |
| SMILES | CCOC(=O)C(CC(C)C)C(=O)Nc1ccc(CN)cc1.Cl |
| InChI | InChI=1S/C16H24N2O3.ClH/c1-4-21-16(20)14(9-11(2)3)15(19)18-13-7-5-12(10-17)6-8-13;/h5-8,11,14H,4,9-10,17H2,1-3H3,(H,18,19);1H |
| InChIKey | BNVOHQPLMZEPFS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|