C26H37N5O3 — CID 169172188
ethyl 2-[[4-[[amino-[(Z)-2-amino-3-(4-methylanilino)prop-1-enyl]amino]methyl]phenyl]carbamoyl]-4-methylpentanoate (PubChem CID 169172188) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is ethyl 2-[[4-[[amino-[(Z)-2-amino-3-(4-methylanilino)prop-1-enyl]amino]methyl]phenyl]carbamoyl]-4-methylpentanoate.
| Compound Name | ethyl 2-[[4-[[amino-[(Z)-2-amino-3-(4-methylanilino)prop-1-enyl]amino]methyl]phenyl]carbamoyl]-4-methylpentanoate |
|---|---|
| PubChem CID | 169172188 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | ethyl 2-[[4-[[amino-[(Z)-2-amino-3-(4-methylanilino)prop-1-enyl]amino]methyl]phenyl]carbamoyl]-4-methylpentanoate |
| SMILES | CCOC(=O)C(CC(C)C)C(=O)Nc1ccc(CN(N)/C=C(\N)CNc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H37N5O3/c1-5-34-26(33)24(14-18(2)3)25(32)30-23-12-8-20(9-13-23)16-31(28)17-21(27)15-29-22-10-6-19(4)7-11-22/h6-13,17-18,24,29H,5,14-16,27-28H2,1-4H3,(H,30,32)/b21-17- |
| InChIKey | HZDUNJQRHXVLAD-FXBPSFAMSA-N |
| XLogP | 3.75 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|