C17H28N6O3 — CID 169172039
N-[4-[[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]methyl]phenyl]-N'-hydroxy-2-(2-methylpropyl)propanediamide (PubChem CID 169172039) has the molecular formula C17H28N6O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[4-[[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]methyl]phenyl]-N'-hydroxy-2-(2-methylpropyl)propanediamide.
| Compound Name | N-[4-[[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]methyl]phenyl]-N'-hydroxy-2-(2-methylpropyl)propanediamide |
|---|---|
| PubChem CID | 169172039 |
| Molecular Formula | C17H28N6O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-[4-[[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]methyl]phenyl]-N'-hydroxy-2-(2-methylpropyl)propanediamide |
| SMILES | CC(C)CC(C(=O)NO)C(=O)Nc1ccc(CN(N)/C=C(\N)CN)cc1 |
| InChI | InChI=1S/C17H28N6O3/c1-11(2)7-15(17(25)22-26)16(24)21-14-5-3-12(4-6-14)9-23(20)10-13(19)8-18/h3-6,10-11,15,26H,7-9,18-20H2,1-2H3,(H,21,24)(H,22,25)/b13-10- |
| InChIKey | UJBVIAIYLDMDQN-RAXLEYEMSA-N |
| XLogP | 0.23 |
| TPSA | 159.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|