C24H29IN6O5S — CID 175935811
N-hydroxy-N'-[4-[[4-[[(4-iodophenyl)sulfonyl-methylamino]methyl]triazol-1-yl]methyl]phenyl]-2-(2-methylpropyl)propanediamide (PubChem CID 175935811) has the molecular formula C24H29IN6O5S and a molecular weight of 640.50 g/mol. Its IUPAC name is N-hydroxy-N'-[4-[[4-[[(4-iodophenyl)sulfonyl-methylamino]methyl]triazol-1-yl]methyl]phenyl]-2-(2-methylpropyl)propanediamide.
| Compound Name | N-hydroxy-N'-[4-[[4-[[(4-iodophenyl)sulfonyl-methylamino]methyl]triazol-1-yl]methyl]phenyl]-2-(2-methylpropyl)propanediamide |
|---|---|
| PubChem CID | 175935811 |
| Molecular Formula | C24H29IN6O5S |
| Molecular Weight | 640.50 g/mol |
| Exact Mass | 640.10 |
| IUPAC Name | N-hydroxy-N'-[4-[[4-[[(4-iodophenyl)sulfonyl-methylamino]methyl]triazol-1-yl]methyl]phenyl]-2-(2-methylpropyl)propanediamide |
| SMILES | CC(C)CC(C(=O)NO)C(=O)Nc1ccc(Cn2cc(CN(C)S(=O)(=O)c3ccc(I)cc3)nn2)cc1 |
| InChI | InChI=1S/C24H29IN6O5S/c1-16(2)12-22(24(33)28-34)23(32)26-19-8-4-17(5-9-19)13-31-15-20(27-29-31)14-30(3)37(35,36)21-10-6-18(25)7-11-21/h4-11,15-16,22,34H,12-14H2,1-3H3,(H,26,32)(H,28,33) |
| InChIKey | DUPITXULOWXGSN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|