C28H37N7O7S — CID 169172113
tert-butyl N-[4-[[1-[[4-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]phenyl]methyl]triazol-4-yl]methylsulfamoyl]phenyl]carbamate (PubChem CID 169172113) has the molecular formula C28H37N7O7S and a molecular weight of 615.71 g/mol. Its IUPAC name is tert-butyl N-[4-[[1-[[4-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]phenyl]methyl]triazol-4-yl]methylsulfamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[1-[[4-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]phenyl]methyl]triazol-4-yl]methylsulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 169172113 |
| Molecular Formula | C28H37N7O7S |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | tert-butyl N-[4-[[1-[[4-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]phenyl]methyl]triazol-4-yl]methylsulfamoyl]phenyl]carbamate |
| SMILES | CC(C)CC(C(=O)NO)C(=O)Nc1ccc(Cn2cc(CNS(=O)(=O)c3ccc(NC(=O)OC(C)(C)C)cc3)nn2)cc1 |
| InChI | InChI=1S/C28H37N7O7S/c1-18(2)14-24(26(37)33-39)25(36)30-20-8-6-19(7-9-20)16-35-17-22(32-34-35)15-29-43(40,41)23-12-10-21(11-13-23)31-27(38)42-28(3,4)5/h6-13,17-18,24,29,39H,14-16H2,1-5H3,(H,30,36)(H,31,38)(H,33,37) |
| InChIKey | MNKMPRFXPVZHPJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 193.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|