C25H30N6O7S — CID 169172121
methyl 4-[[1-[[4-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]phenyl]methyl]triazol-4-yl]methylsulfamoyl]benzoate (PubChem CID 169172121) has the molecular formula C25H30N6O7S and a molecular weight of 558.62 g/mol. Its IUPAC name is methyl 4-[[1-[[4-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]phenyl]methyl]triazol-4-yl]methylsulfamoyl]benzoate.
| Compound Name | methyl 4-[[1-[[4-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]phenyl]methyl]triazol-4-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 169172121 |
| Molecular Formula | C25H30N6O7S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | methyl 4-[[1-[[4-[[2-(hydroxycarbamoyl)-4-methylpentanoyl]amino]phenyl]methyl]triazol-4-yl]methylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCc2cn(Cc3ccc(NC(=O)C(CC(C)C)C(=O)NO)cc3)nn2)cc1 |
| InChI | InChI=1S/C25H30N6O7S/c1-16(2)12-22(24(33)29-35)23(32)27-19-8-4-17(5-9-19)14-31-15-20(28-30-31)13-26-39(36,37)21-10-6-18(7-11-21)25(34)38-3/h4-11,15-16,22,26,35H,12-14H2,1-3H3,(H,27,32)(H,29,33) |
| InChIKey | YKBHEVOKTWBBRC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 181.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|