C29H40N6O3S — CID 169172153
N-[4-[[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]methyl]phenyl]-2-benzyl-N'-hydroxypropanediamide;ethane;4-methylbenzenethiol (PubChem CID 169172153) has the molecular formula C29H40N6O3S and a molecular weight of 552.75 g/mol. Its IUPAC name is N-[4-[[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]methyl]phenyl]-2-benzyl-N'-hydroxypropanediamide;ethane;4-methylbenzenethiol.
| Compound Name | N-[4-[[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]methyl]phenyl]-2-benzyl-N'-hydroxypropanediamide;ethane;4-methylbenzenethiol |
|---|---|
| PubChem CID | 169172153 |
| Molecular Formula | C29H40N6O3S |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | N-[4-[[amino-[(Z)-2,3-diaminoprop-1-enyl]amino]methyl]phenyl]-2-benzyl-N'-hydroxypropanediamide;ethane;4-methylbenzenethiol |
| SMILES | CC.Cc1ccc(S)cc1.NC/C(N)=C/N(N)Cc1ccc(NC(=O)C(Cc2ccccc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C20H26N6O3.C7H8S.C2H6/c21-11-16(22)13-26(23)12-15-6-8-17(9-7-15)24-19(27)18(20(28)25-29)10-14-4-2-1-3-5-14;1-6-2-4-7(8)5-3-6;1-2/h1-9,13,18,29H,10-12,21-23H2,(H,24,27)(H,25,28);2-5,8H,1H3;1-2H3/b16-13-;; |
| InChIKey | BAXRAQSJAGEDJU-CUKDSWIPSA-N |
| XLogP | 3.73 |
| TPSA | 159.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|