C22H23ClN4O4 — CID 177451672
ethyl 2-[(Z)-[2-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]-1-phenylethylidene]amino]oxypropanoate (PubChem CID 177451672) has the molecular formula C22H23ClN4O4 and a molecular weight of 442.90 g/mol. Its IUPAC name is ethyl 2-[(Z)-[2-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]-1-phenylethylidene]amino]oxypropanoate.
| Compound Name | ethyl 2-[(Z)-[2-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]-1-phenylethylidene]amino]oxypropanoate |
|---|---|
| PubChem CID | 177451672 |
| Molecular Formula | C22H23ClN4O4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | ethyl 2-[(Z)-[2-[4-[(4-chlorophenoxy)methyl]triazol-1-yl]-1-phenylethylidene]amino]oxypropanoate |
| SMILES | CCOC(=O)C(C)O/N=C(\Cn1cc(COc2ccc(Cl)cc2)nn1)c1ccccc1 |
| InChI | InChI=1S/C22H23ClN4O4/c1-3-29-22(28)16(2)31-25-21(17-7-5-4-6-8-17)14-27-13-19(24-26-27)15-30-20-11-9-18(23)10-12-20/h4-13,16H,3,14-15H2,1-2H3/b25-21+ |
| InChIKey | PSPLQDPEBRIHLY-NJNXFGOHSA-N |
| XLogP | 3.88 |
| TPSA | 87.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|