C6H9NS — CID 143022946
(3Z)-4-(methylideneamino)penta-1,3-diene-2-thiol (PubChem CID 143022946) has the molecular formula C6H9NS and a molecular weight of 127.21 g/mol. Its IUPAC name is (3Z)-4-(methylideneamino)penta-1,3-diene-2-thiol.
| Compound Name | (3Z)-4-(methylideneamino)penta-1,3-diene-2-thiol |
|---|---|
| PubChem CID | 143022946 |
| Molecular Formula | C6H9NS |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | (3Z)-4-(methylideneamino)penta-1,3-diene-2-thiol |
| SMILES | C=N/C(C)=C\C(=C)S |
| InChI | InChI=1S/C6H9NS/c1-5(7-3)4-6(2)8/h4,8H,2-3H2,1H3/b5-4- |
| InChIKey | MVTMNFBTXVZWES-PLNGDYQASA-N |
| XLogP | 2.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|