C24H26N4O3 — CID 143026739
N-(2-amino-5-cyanophenyl)formamide;3,4-dimethoxy-N-[(4-methylphenyl)methyl]aniline (PubChem CID 143026739) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-(2-amino-5-cyanophenyl)formamide;3,4-dimethoxy-N-[(4-methylphenyl)methyl]aniline.
| Compound Name | N-(2-amino-5-cyanophenyl)formamide;3,4-dimethoxy-N-[(4-methylphenyl)methyl]aniline |
|---|---|
| PubChem CID | 143026739 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-(2-amino-5-cyanophenyl)formamide;3,4-dimethoxy-N-[(4-methylphenyl)methyl]aniline |
| SMILES | COc1ccc(NCc2ccc(C)cc2)cc1OC.N#Cc1ccc(N)c(NC=O)c1 |
| InChI | InChI=1S/C16H19NO2.C8H7N3O/c1-12-4-6-13(7-5-12)11-17-14-8-9-15(18-2)16(10-14)19-3;9-4-6-1-2-7(10)8(3-6)11-5-12/h4-10,17H,11H2,1-3H3;1-3,5H,10H2,(H,11,12) |
| InChIKey | CCSWUMMKPBHLMY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|