C20H24N4O — CID 143027583
1-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-8-ylamino)acetyl]pyrrolidine-2-carbonitrile (PubChem CID 143027583) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-8-ylamino)acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | 1-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-8-ylamino)acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 143027583 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-[2-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-8-ylamino)acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#CC1CCCN1C(=O)CNC1CCc2[nH]c3ccccc3c2CC1 |
| InChI | InChI=1S/C20H24N4O/c21-12-15-4-3-11-24(15)20(25)13-22-14-7-9-17-16-5-1-2-6-18(16)23-19(17)10-8-14/h1-2,5-6,14-15,22-23H,3-4,7-11,13H2 |
| InChIKey | XNFRSMKRZGIYMH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|