C30H26 — CID 143027770
(3'S)-3',4'-diphenylspiro[8H-benzo[a]azulene-10,1'-cyclopentane] (PubChem CID 143027770) has the molecular formula C30H26 and a molecular weight of 386.54 g/mol. Its IUPAC name is (3'S)-3',4'-diphenylspiro[8H-benzo[a]azulene-10,1'-cyclopentane].
| Compound Name | (3'S)-3',4'-diphenylspiro[8H-benzo[a]azulene-10,1'-cyclopentane] |
|---|---|
| PubChem CID | 143027770 |
| Molecular Formula | C30H26 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (3'S)-3',4'-diphenylspiro[8H-benzo[a]azulene-10,1'-cyclopentane] |
| SMILES | C1=CCC=C2C(=C1)c1ccccc1C21CC(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C30H26/c1-4-12-22(13-5-1)26-20-30(21-27(26)23-14-6-2-7-15-23)28-18-9-3-8-16-24(28)25-17-10-11-19-29(25)30/h1-8,10-19,26-27H,9,20-21H2/t26-,27?,30?/m1/s1 |
| InChIKey | LGTNGQLBPRFLAT-FVEFLQRYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |