C16H10BrF6N3OS — CID 143033028
N-[4-bromo-2-(trifluoromethoxy)phenyl]sulfanyl-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methanamine (PubChem CID 143033028) has the molecular formula C16H10BrF6N3OS and a molecular weight of 486.24 g/mol. Its IUPAC name is N-[4-bromo-2-(trifluoromethoxy)phenyl]sulfanyl-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methanamine.
| Compound Name | N-[4-bromo-2-(trifluoromethoxy)phenyl]sulfanyl-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 143033028 |
| Molecular Formula | C16H10BrF6N3OS |
| Molecular Weight | 486.24 g/mol |
| Exact Mass | 484.96 |
| IUPAC Name | N-[4-bromo-2-(trifluoromethoxy)phenyl]sulfanyl-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methanamine |
| SMILES | FC(F)(F)Oc1cc(Br)ccc1SNCc1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C16H10BrF6N3OS/c17-9-2-4-13(12(6-9)27-16(21,22)23)28-24-7-14-25-10-3-1-8(15(18,19)20)5-11(10)26-14/h1-6,24H,7H2,(H,25,26) |
| InChIKey | BGFGAPKSNMTQPE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.24 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|