C29H24F2N2O7S — CID 143035366
[4-[2-[4-[[5-[4-(difluoromethoxy)phenyl]-2-methylfuran-3-carbonyl]amino]phenyl]acetyl]sulfinamoylphenyl] acetate (PubChem CID 143035366) has the molecular formula C29H24F2N2O7S and a molecular weight of 582.58 g/mol. Its IUPAC name is [4-[2-[4-[[5-[4-(difluoromethoxy)phenyl]-2-methylfuran-3-carbonyl]amino]phenyl]acetyl]sulfinamoylphenyl] acetate.
| Compound Name | [4-[2-[4-[[5-[4-(difluoromethoxy)phenyl]-2-methylfuran-3-carbonyl]amino]phenyl]acetyl]sulfinamoylphenyl] acetate |
|---|---|
| PubChem CID | 143035366 |
| Molecular Formula | C29H24F2N2O7S |
| Molecular Weight | 582.58 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | [4-[2-[4-[[5-[4-(difluoromethoxy)phenyl]-2-methylfuran-3-carbonyl]amino]phenyl]acetyl]sulfinamoylphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(S(=O)NC(=O)Cc2ccc(NC(=O)c3cc(-c4ccc(OC(F)F)cc4)oc3C)cc2)cc1 |
| InChI | InChI=1S/C29H24F2N2O7S/c1-17-25(16-26(38-17)20-5-9-23(10-6-20)40-29(30)31)28(36)32-21-7-3-19(4-8-21)15-27(35)33-41(37)24-13-11-22(12-14-24)39-18(2)34/h3-14,16,29H,15H2,1-2H3,(H,32,36)(H,33,35) |
| InChIKey | QZMILEUMXBFJSS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|