C17H17F2NO2 — CID 143043409
(2,6-difluorophenyl) 2-methyl-6-(2-methylpropyl)pyridine-3-carboxylate (PubChem CID 143043409) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is (2,6-difluorophenyl) 2-methyl-6-(2-methylpropyl)pyridine-3-carboxylate.
| Compound Name | (2,6-difluorophenyl) 2-methyl-6-(2-methylpropyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 143043409 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2,6-difluorophenyl) 2-methyl-6-(2-methylpropyl)pyridine-3-carboxylate |
| SMILES | Cc1nc(CC(C)C)ccc1C(=O)Oc1c(F)cccc1F |
| InChI | InChI=1S/C17H17F2NO2/c1-10(2)9-12-7-8-13(11(3)20-12)17(21)22-16-14(18)5-4-6-15(16)19/h4-8,10H,9H2,1-3H3 |
| InChIKey | CEYLAPLYVYBXQR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|