C14H11ClF2N4S — CID 143045052
N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(1,1-difluoroethyl)-1,3-thiazol-5-amine (PubChem CID 143045052) has the molecular formula C14H11ClF2N4S and a molecular weight of 340.79 g/mol. Its IUPAC name is N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(1,1-difluoroethyl)-1,3-thiazol-5-amine.
| Compound Name | N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(1,1-difluoroethyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 143045052 |
| Molecular Formula | C14H11ClF2N4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-(7-chloro-2-methyl-1,8-naphthyridin-4-yl)-2-(1,1-difluoroethyl)-1,3-thiazol-5-amine |
| SMILES | Cc1cc(Nc2cnc(C(C)(F)F)s2)c2ccc(Cl)nc2n1 |
| InChI | InChI=1S/C14H11ClF2N4S/c1-7-5-9(8-3-4-10(15)21-12(8)19-7)20-11-6-18-13(22-11)14(2,16)17/h3-6H,1-2H3,(H,19,20,21) |
| InChIKey | FMYQORKPGYIKAB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|