C26H41ClN4O4 — CID 143045286
4-[4-[4-(5-chloropentyl)phenyl]piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidine-4-carboxamide;formaldehyde (PubChem CID 143045286) has the molecular formula C26H41ClN4O4 and a molecular weight of 509.09 g/mol. Its IUPAC name is 4-[4-[4-(5-chloropentyl)phenyl]piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidine-4-carboxamide;formaldehyde.
| Compound Name | 4-[4-[4-(5-chloropentyl)phenyl]piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidine-4-carboxamide;formaldehyde |
|---|---|
| PubChem CID | 143045286 |
| Molecular Formula | C26H41ClN4O4 |
| Molecular Weight | 509.09 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 4-[4-[4-(5-chloropentyl)phenyl]piperazine-1-carbonyl]-1-(2-methoxyethyl)piperidine-4-carboxamide;formaldehyde |
| SMILES | C=O.COCCN1CCC(C(N)=O)(C(=O)N2CCN(c3ccc(CCCCCCl)cc3)CC2)CC1 |
| InChI | InChI=1S/C25H39ClN4O3.CH2O/c1-33-20-19-28-13-10-25(11-14-28,23(27)31)24(32)30-17-15-29(16-18-30)22-8-6-21(7-9-22)5-3-2-4-12-26;1-2/h6-9H,2-5,10-20H2,1H3,(H2,27,31);1H2 |
| InChIKey | QOYIDIWWSPUPHB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.09 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|