C16H17ClF3N3O3 — CID 143045911
ethyl 1-(2-chlorophenyl)-4-[2-(2,2,2-trifluoroethylamino)ethoxy]pyrazole-3-carboxylate (PubChem CID 143045911) has the molecular formula C16H17ClF3N3O3 and a molecular weight of 391.78 g/mol. Its IUPAC name is ethyl 1-(2-chlorophenyl)-4-[2-(2,2,2-trifluoroethylamino)ethoxy]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(2-chlorophenyl)-4-[2-(2,2,2-trifluoroethylamino)ethoxy]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 143045911 |
| Molecular Formula | C16H17ClF3N3O3 |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | ethyl 1-(2-chlorophenyl)-4-[2-(2,2,2-trifluoroethylamino)ethoxy]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2Cl)cc1OCCNCC(F)(F)F |
| InChI | InChI=1S/C16H17ClF3N3O3/c1-2-25-15(24)14-13(26-8-7-21-10-16(18,19)20)9-23(22-14)12-6-4-3-5-11(12)17/h3-6,9,21H,2,7-8,10H2,1H3 |
| InChIKey | PLZVZASCFHXVDQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|