C24H28 — CID 143048502
1-but-3-enyl-2-[2-[4-[(E)-3-methylbut-1-enyl]phenyl]prop-2-enyl]benzene (PubChem CID 143048502) has the molecular formula C24H28 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-but-3-enyl-2-[2-[4-[(E)-3-methylbut-1-enyl]phenyl]prop-2-enyl]benzene.
| Compound Name | 1-but-3-enyl-2-[2-[4-[(E)-3-methylbut-1-enyl]phenyl]prop-2-enyl]benzene |
|---|---|
| PubChem CID | 143048502 |
| Molecular Formula | C24H28 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-but-3-enyl-2-[2-[4-[(E)-3-methylbut-1-enyl]phenyl]prop-2-enyl]benzene |
| SMILES | C=CCCc1ccccc1CC(=C)c1ccc(/C=C/C(C)C)cc1 |
| InChI | InChI=1S/C24H28/c1-5-6-9-23-10-7-8-11-24(23)18-20(4)22-16-14-21(15-17-22)13-12-19(2)3/h5,7-8,10-17,19H,1,4,6,9,18H2,2-3H3/b13-12+ |
| InChIKey | CWWUPDIGGUWLLO-OUKQBFOZSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|