C16H16ClF3N4O3 — CID 143049979
N-[4-chloro-2-(2-hydroxypropan-2-ylcarbamoyl)-6-methylphenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 143049979) has the molecular formula C16H16ClF3N4O3 and a molecular weight of 404.78 g/mol. Its IUPAC name is N-[4-chloro-2-(2-hydroxypropan-2-ylcarbamoyl)-6-methylphenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[4-chloro-2-(2-hydroxypropan-2-ylcarbamoyl)-6-methylphenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 143049979 |
| Molecular Formula | C16H16ClF3N4O3 |
| Molecular Weight | 404.78 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-[4-chloro-2-(2-hydroxypropan-2-ylcarbamoyl)-6-methylphenyl]-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NC(C)(C)O)c1NC(=O)c1cc(C(F)(F)F)[nH]n1 |
| InChI | InChI=1S/C16H16ClF3N4O3/c1-7-4-8(17)5-9(13(25)22-15(2,3)27)12(7)21-14(26)10-6-11(24-23-10)16(18,19)20/h4-6,27H,1-3H3,(H,21,26)(H,22,25)(H,23,24) |
| InChIKey | BEMLQHVNFMYPAI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.78 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|