C11H6ClF3N2O2 — CID 171349224
(5-chloro-2-hydroxyphenyl)-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone (PubChem CID 171349224) has the molecular formula C11H6ClF3N2O2 and a molecular weight of 290.63 g/mol. Its IUPAC name is (5-chloro-2-hydroxyphenyl)-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone.
| Compound Name | (5-chloro-2-hydroxyphenyl)-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 171349224 |
| Molecular Formula | C11H6ClF3N2O2 |
| Molecular Weight | 290.63 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | (5-chloro-2-hydroxyphenyl)-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)[nH]n1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C11H6ClF3N2O2/c12-5-1-2-8(18)6(3-5)10(19)7-4-9(17-16-7)11(13,14)15/h1-4,18H,(H,16,17) |
| InChIKey | UAOWYFVASWVCQH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |