C10H17NO2 — CID 143052133
N-[(3Z)-4-methoxy-5,5-dimethylhexa-1,3-dien-2-yl]formamide (PubChem CID 143052133) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is N-[(3Z)-4-methoxy-5,5-dimethylhexa-1,3-dien-2-yl]formamide.
| Compound Name | N-[(3Z)-4-methoxy-5,5-dimethylhexa-1,3-dien-2-yl]formamide |
|---|---|
| PubChem CID | 143052133 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N-[(3Z)-4-methoxy-5,5-dimethylhexa-1,3-dien-2-yl]formamide |
| SMILES | C=C(/C=C(\OC)C(C)(C)C)NC=O |
| InChI | InChI=1S/C10H17NO2/c1-8(11-7-12)6-9(13-5)10(2,3)4/h6-7H,1H2,2-5H3,(H,11,12)/b9-6- |
| InChIKey | IFFIWPXHDGUJGB-TWGQIWQCSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|