C35H44N4O6 — CID 143053504
(10S,13S,15E,17R)-4-(4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-8,10,13,15,17-pentamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone (PubChem CID 143053504) has the molecular formula C35H44N4O6 and a molecular weight of 616.76 g/mol. Its IUPAC name is (10S,13S,15E,17R)-4-(4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-8,10,13,15,17-pentamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone.
| Compound Name | (10S,13S,15E,17R)-4-(4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-8,10,13,15,17-pentamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |
|---|---|
| PubChem CID | 143053504 |
| Molecular Formula | C35H44N4O6 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | (10S,13S,15E,17R)-4-(4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-8,10,13,15,17-pentamethyl-1-oxa-5,8,11-triazacyclononadec-15-ene-2,6,9,12-tetrone |
| SMILES | C/C1=C\[C@H](C)CCOC(=O)CC(c2ccc(O)cc2)NC(=O)C(Cc2c[nH]c3ccccc23)N(C)C(=O)[C@H](C)NC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C35H44N4O6/c1-21-14-15-45-32(41)19-30(25-10-12-27(40)13-11-25)38-34(43)31(18-26-20-36-29-9-7-6-8-28(26)29)39(5)35(44)24(4)37-33(42)23(3)17-22(2)16-21/h6-13,16,20-21,23-24,30-31,36,40H,14-15,17-19H2,1-5H3,(H,37,42)(H,38,43)/b22-16+/t21-,23+,24+,30?,31?/m1/s1 |
| InChIKey | CLRFMEUAGGJMQL-GDJCIORBSA-N |
| XLogP | 4.55 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|