C37H45N5O6 — CID 102227271
4-[(15E)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-2,6,9,12-tetraoxo-1-oxa-5,8,11-triazacyclooctadec-15-en-4-yl]benzonitrile (PubChem CID 102227271) has the molecular formula C37H45N5O6 and a molecular weight of 655.80 g/mol. Its IUPAC name is 4-[(15E)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-2,6,9,12-tetraoxo-1-oxa-5,8,11-triazacyclooctadec-15-en-4-yl]benzonitrile.
| Compound Name | 4-[(15E)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-2,6,9,12-tetraoxo-1-oxa-5,8,11-triazacyclooctadec-15-en-4-yl]benzonitrile |
|---|---|
| PubChem CID | 102227271 |
| Molecular Formula | C37H45N5O6 |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.34 |
| IUPAC Name | 4-[(15E)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-2,6,9,12-tetraoxo-1-oxa-5,8,11-triazacyclooctadec-15-en-4-yl]benzonitrile |
| SMILES | COC1C(=O)OC(C)C(C)/C=C(\C)CC(C)C(=O)NC(C)C(=O)N(C)C(Cc2c[nH]c3ccccc23)C(=O)NC1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C37H45N5O6/c1-21-16-22(2)25(5)48-37(46)33(47-7)32(27-14-12-26(19-38)13-15-27)41-35(44)31(18-28-20-39-30-11-9-8-10-29(28)30)42(6)36(45)24(4)40-34(43)23(3)17-21/h8-16,20,22-25,31-33,39H,17-18H2,1-7H3,(H,40,43)(H,41,44)/b21-16+ |
| InChIKey | VZOLQVCKHACDQW-LTGZKZEYSA-N |
| XLogP | 4.34 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|