C36H45ClN4O7 — CID 163062702
4-(3-chloro-4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone (PubChem CID 163062702) has the molecular formula C36H45ClN4O7 and a molecular weight of 681.23 g/mol. Its IUPAC name is 4-(3-chloro-4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone.
| Compound Name | 4-(3-chloro-4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone |
|---|---|
| PubChem CID | 163062702 |
| Molecular Formula | C36H45ClN4O7 |
| Molecular Weight | 681.23 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | 4-(3-chloro-4-hydroxyphenyl)-7-(1H-indol-3-ylmethyl)-3-methoxy-8,10,13,15,17,18-hexamethyl-1-oxa-5,8,11-triazacyclooctadec-15-ene-2,6,9,12-tetrone |
| SMILES | COC1C(=O)OC(C)C(C)C=C(C)CC(C)C(=O)NC(C)C(=O)N(C)C(Cc2c[nH]c3ccccc23)C(=O)NC1c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C36H45ClN4O7/c1-19-14-20(2)23(5)48-36(46)32(47-7)31(24-12-13-30(42)27(37)16-24)40-34(44)29(17-25-18-38-28-11-9-8-10-26(25)28)41(6)35(45)22(4)39-33(43)21(3)15-19/h8-14,16,18,20-23,29,31-32,38,42H,15,17H2,1-7H3,(H,39,43)(H,40,44) |
| InChIKey | MWOUIFPDXGZUPG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.23 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|