C28H40ClN3O7 — CID 163173048
6-[(3-chloro-4-hydroxyphenyl)methyl]-9-(hydroxymethyl)-3,7,12,14,16,18-hexamethyl-1-oxa-4,7,10-triazacyclooctadec-14-ene-2,5,8,11-tetrone (PubChem CID 163173048) has the molecular formula C28H40ClN3O7 and a molecular weight of 566.10 g/mol. Its IUPAC name is 6-[(3-chloro-4-hydroxyphenyl)methyl]-9-(hydroxymethyl)-3,7,12,14,16,18-hexamethyl-1-oxa-4,7,10-triazacyclooctadec-14-ene-2,5,8,11-tetrone.
| Compound Name | 6-[(3-chloro-4-hydroxyphenyl)methyl]-9-(hydroxymethyl)-3,7,12,14,16,18-hexamethyl-1-oxa-4,7,10-triazacyclooctadec-14-ene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 163173048 |
| Molecular Formula | C28H40ClN3O7 |
| Molecular Weight | 566.10 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 6-[(3-chloro-4-hydroxyphenyl)methyl]-9-(hydroxymethyl)-3,7,12,14,16,18-hexamethyl-1-oxa-4,7,10-triazacyclooctadec-14-ene-2,5,8,11-tetrone |
| SMILES | CC1=CC(C)CC(C)OC(=O)C(C)NC(=O)C(Cc2ccc(O)c(Cl)c2)N(C)C(=O)C(CO)NC(=O)C(C)C1 |
| InChI | InChI=1S/C28H40ClN3O7/c1-15-9-16(2)11-18(4)39-28(38)19(5)30-26(36)23(13-20-7-8-24(34)21(29)12-20)32(6)27(37)22(14-33)31-25(35)17(3)10-15/h7-9,12,16-19,22-23,33-34H,10-11,13-14H2,1-6H3,(H,30,36)(H,31,35) |
| InChIKey | WDSBWVUCICAVHQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.10 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|