C27H38BrN3O7 — CID 163151387
(3S,6R,12S,14E,16R,18S)-6-[(3-bromo-4-hydroxyphenyl)methyl]-3-(hydroxymethyl)-7,12,14,16,18-pentamethyl-1-oxa-4,7,10-triazacyclooctadec-14-ene-2,5,8,11-tetrone (PubChem CID 163151387) has the molecular formula C27H38BrN3O7 and a molecular weight of 596.52 g/mol. Its IUPAC name is (3S,6R,12S,14E,16R,18S)-6-[(3-bromo-4-hydroxyphenyl)methyl]-3-(hydroxymethyl)-7,12,14,16,18-pentamethyl-1-oxa-4,7,10-triazacyclooctadec-14-ene-2,5,8,11-tetrone.
| Compound Name | (3S,6R,12S,14E,16R,18S)-6-[(3-bromo-4-hydroxyphenyl)methyl]-3-(hydroxymethyl)-7,12,14,16,18-pentamethyl-1-oxa-4,7,10-triazacyclooctadec-14-ene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 163151387 |
| Molecular Formula | C27H38BrN3O7 |
| Molecular Weight | 596.52 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | (3S,6R,12S,14E,16R,18S)-6-[(3-bromo-4-hydroxyphenyl)methyl]-3-(hydroxymethyl)-7,12,14,16,18-pentamethyl-1-oxa-4,7,10-triazacyclooctadec-14-ene-2,5,8,11-tetrone |
| SMILES | C/C1=C\[C@H](C)C[C@H](C)OC(=O)[C@H](CO)NC(=O)[C@@H](Cc2ccc(O)c(Br)c2)N(C)C(=O)CNC(=O)[C@@H](C)C1 |
| InChI | InChI=1S/C27H38BrN3O7/c1-15-8-16(2)10-18(4)38-27(37)21(14-32)30-26(36)22(12-19-6-7-23(33)20(28)11-19)31(5)24(34)13-29-25(35)17(3)9-15/h6-8,11,16-18,21-22,32-33H,9-10,12-14H2,1-5H3,(H,29,35)(H,30,36)/b15-8+/t16-,17-,18-,21-,22+/m0/s1 |
| InChIKey | NLIYEKNSMRALAW-OOZVTPSZSA-N |
| XLogP | 2.06 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|