C33H40BrN3O7 — CID 146162767
(6R,9S,15E,19S)-3-benzoyl-6-[(3-bromo-4-hydroxyphenyl)methyl]-7,9,16,19-tetramethyl-1-oxa-4,7,10-triazacyclononadec-15-ene-2,5,8,11-tetrone (PubChem CID 146162767) has the molecular formula C33H40BrN3O7 and a molecular weight of 670.60 g/mol. Its IUPAC name is (6R,9S,15E,19S)-3-benzoyl-6-[(3-bromo-4-hydroxyphenyl)methyl]-7,9,16,19-tetramethyl-1-oxa-4,7,10-triazacyclononadec-15-ene-2,5,8,11-tetrone.
| Compound Name | (6R,9S,15E,19S)-3-benzoyl-6-[(3-bromo-4-hydroxyphenyl)methyl]-7,9,16,19-tetramethyl-1-oxa-4,7,10-triazacyclononadec-15-ene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 146162767 |
| Molecular Formula | C33H40BrN3O7 |
| Molecular Weight | 670.60 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | (6R,9S,15E,19S)-3-benzoyl-6-[(3-bromo-4-hydroxyphenyl)methyl]-7,9,16,19-tetramethyl-1-oxa-4,7,10-triazacyclononadec-15-ene-2,5,8,11-tetrone |
| SMILES | C/C1=C\CCCC(=O)N[C@@H](C)C(=O)N(C)[C@H](Cc2ccc(O)c(Br)c2)C(=O)NC(C(=O)c2ccccc2)C(=O)O[C@@H](C)CC1 |
| InChI | InChI=1S/C33H40BrN3O7/c1-20-10-8-9-13-28(39)35-22(3)32(42)37(4)26(19-23-16-17-27(38)25(34)18-23)31(41)36-29(33(43)44-21(2)15-14-20)30(40)24-11-6-5-7-12-24/h5-7,10-12,16-18,21-22,26,29,38H,8-9,13-15,19H2,1-4H3,(H,35,39)(H,36,41)/b20-10+/t21-,22-,26+,29?/m0/s1 |
| InChIKey | PFISZTVHMXNMTO-SAULHYAYSA-N |
| XLogP | 4.24 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|