C23H27N5O4S — CID 143054050
N-[2-[4-[4-[(Z)-2-amino-3-methylsulfanylprop-2-enoxy]-3-methylanilino]quinazolin-5-yl]oxyethyl]-2-hydroxyacetamide (PubChem CID 143054050) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is N-[2-[4-[4-[(Z)-2-amino-3-methylsulfanylprop-2-enoxy]-3-methylanilino]quinazolin-5-yl]oxyethyl]-2-hydroxyacetamide.
| Compound Name | N-[2-[4-[4-[(Z)-2-amino-3-methylsulfanylprop-2-enoxy]-3-methylanilino]quinazolin-5-yl]oxyethyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 143054050 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[2-[4-[4-[(Z)-2-amino-3-methylsulfanylprop-2-enoxy]-3-methylanilino]quinazolin-5-yl]oxyethyl]-2-hydroxyacetamide |
| SMILES | CS/C=C(\N)COc1ccc(Nc2ncnc3cccc(OCCNC(=O)CO)c23)cc1C |
| InChI | InChI=1S/C23H27N5O4S/c1-15-10-17(6-7-19(15)32-12-16(24)13-33-2)28-23-22-18(26-14-27-23)4-3-5-20(22)31-9-8-25-21(30)11-29/h3-7,10,13-14,29H,8-9,11-12,24H2,1-2H3,(H,25,30)(H,26,27,28)/b16-13- |
| InChIKey | FFWQXLADQMZHLH-SSZFMOIBSA-N |
| XLogP | 2.71 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|