C20H22N4O3 — CID 90761748
N-[2-[4-(4-hydroxy-3-methylanilino)quinazolin-5-yl]oxyethyl]propanamide (PubChem CID 90761748) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[2-[4-(4-hydroxy-3-methylanilino)quinazolin-5-yl]oxyethyl]propanamide.
| Compound Name | N-[2-[4-(4-hydroxy-3-methylanilino)quinazolin-5-yl]oxyethyl]propanamide |
|---|---|
| PubChem CID | 90761748 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[2-[4-(4-hydroxy-3-methylanilino)quinazolin-5-yl]oxyethyl]propanamide |
| SMILES | CCC(=O)NCCOc1cccc2ncnc(Nc3ccc(O)c(C)c3)c12 |
| InChI | InChI=1S/C20H22N4O3/c1-3-18(26)21-9-10-27-17-6-4-5-15-19(17)20(23-12-22-15)24-14-7-8-16(25)13(2)11-14/h4-8,11-12,25H,3,9-10H2,1-2H3,(H,21,26)(H,22,23,24) |
| InChIKey | HPLKFSHDTPJXDN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|