C13H22N2O3 — CID 143058195
methyl (2E,4Z)-5-[[2-(diethylamino)-2-oxoethyl]amino]-2-methylpenta-2,4-dienoate (PubChem CID 143058195) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl (2E,4Z)-5-[[2-(diethylamino)-2-oxoethyl]amino]-2-methylpenta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-5-[[2-(diethylamino)-2-oxoethyl]amino]-2-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 143058195 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | methyl (2E,4Z)-5-[[2-(diethylamino)-2-oxoethyl]amino]-2-methylpenta-2,4-dienoate |
| SMILES | CCN(CC)C(=O)CN/C=C\C=C(/C)C(=O)OC |
| InChI | InChI=1S/C13H22N2O3/c1-5-15(6-2)12(16)10-14-9-7-8-11(3)13(17)18-4/h7-9,14H,5-6,10H2,1-4H3/b9-7-,11-8+ |
| InChIKey | WAEHYGCPIWTCJP-BYSFRFKNSA-N |
| XLogP | 1.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|