C20H22O — CID 143060340
2-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-6-methoxynaphthalene (PubChem CID 143060340) has the molecular formula C20H22O and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-6-methoxynaphthalene.
| Compound Name | 2-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-6-methoxynaphthalene |
|---|---|
| PubChem CID | 143060340 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-6-methoxynaphthalene |
| SMILES | C=C(C)/C(=C\C=C(C)C)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C20H22O/c1-14(2)6-11-20(15(3)4)18-8-7-17-13-19(21-5)10-9-16(17)12-18/h6-13H,3H2,1-2,4-5H3/b20-11+ |
| InChIKey | SLWRADBQGIWJIZ-RGVLZGJSSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|