C21H21N3O2 — CID 143061285
8-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-3,4-dihydropyrano[3,4-c]pyridin-1-one (PubChem CID 143061285) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 8-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-3,4-dihydropyrano[3,4-c]pyridin-1-one.
| Compound Name | 8-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-3,4-dihydropyrano[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 143061285 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 8-[4-(3-phenylprop-2-ynyl)piperazin-1-yl]-3,4-dihydropyrano[3,4-c]pyridin-1-one |
| SMILES | O=C1OCCc2ccnc(N3CCN(CC#Cc4ccccc4)CC3)c21 |
| InChI | InChI=1S/C21H21N3O2/c25-21-19-18(9-16-26-21)8-10-22-20(19)24-14-12-23(13-15-24)11-4-7-17-5-2-1-3-6-17/h1-3,5-6,8,10H,9,11-16H2 |
| InChIKey | BILDYFHHEKSHJG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|