C29H32FNO5 — CID 143062392
benzyl (Z)-3-(3-fluoro-2-phenylmethoxyphenyl)-2-formamidoprop-2-enoate;2-methoxy-2-methylpropane (PubChem CID 143062392) has the molecular formula C29H32FNO5 and a molecular weight of 493.58 g/mol. Its IUPAC name is benzyl (Z)-3-(3-fluoro-2-phenylmethoxyphenyl)-2-formamidoprop-2-enoate;2-methoxy-2-methylpropane.
| Compound Name | benzyl (Z)-3-(3-fluoro-2-phenylmethoxyphenyl)-2-formamidoprop-2-enoate;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 143062392 |
| Molecular Formula | C29H32FNO5 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | benzyl (Z)-3-(3-fluoro-2-phenylmethoxyphenyl)-2-formamidoprop-2-enoate;2-methoxy-2-methylpropane |
| SMILES | COC(C)(C)C.O=CN/C(=C\c1cccc(F)c1OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H20FNO4.C5H12O/c25-21-13-7-12-20(23(21)29-15-18-8-3-1-4-9-18)14-22(26-17-27)24(28)30-16-19-10-5-2-6-11-19;1-5(2,3)6-4/h1-14,17H,15-16H2,(H,26,27);1-4H3/b22-14-; |
| InChIKey | BIZOVTYBLSXVLU-YDHFHHHVSA-N |
| XLogP | 5.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|