C24H20BrNO3 — CID 143066752
2-[2-[(4-bromophenyl)-(4-methylphenyl)methoxy]ethyl]isoindole-1,3-dione (PubChem CID 143066752) has the molecular formula C24H20BrNO3 and a molecular weight of 450.33 g/mol. Its IUPAC name is 2-[2-[(4-bromophenyl)-(4-methylphenyl)methoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(4-bromophenyl)-(4-methylphenyl)methoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 143066752 |
| Molecular Formula | C24H20BrNO3 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 2-[2-[(4-bromophenyl)-(4-methylphenyl)methoxy]ethyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(C(OCCN2C(=O)c3ccccc3C2=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C24H20BrNO3/c1-16-6-8-17(9-7-16)22(18-10-12-19(25)13-11-18)29-15-14-26-23(27)20-4-2-3-5-21(20)24(26)28/h2-13,22H,14-15H2,1H3 |
| InChIKey | WCHGTJJUMIDQQW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|