C26H27N3O — CID 143069730
N-benzyl-3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N,5-dimethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 143069730) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is N-benzyl-3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N,5-dimethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-benzyl-3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N,5-dimethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 143069730 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-benzyl-3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-N,5-dimethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | C=C/C=C\C=C(/C)c1nn(-c2ccccc2)c(C)c1C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C26H27N3O/c1-5-6-9-14-20(2)25-24(21(3)29(27-25)23-17-12-8-13-18-23)26(30)28(4)19-22-15-10-7-11-16-22/h5-18H,1,19H2,2-4H3/b9-6-,20-14+ |
| InChIKey | WYHBBUSQWBXWOK-ZZBWDPLRSA-N |
| XLogP | 5.60 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|