C31H39N3O — CID 143069826
ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-phenyl-N-(2-phenylpropan-2-yl)-5-propylpyrazole-4-carboxamide (PubChem CID 143069826) has the molecular formula C31H39N3O and a molecular weight of 469.67 g/mol. Its IUPAC name is ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-phenyl-N-(2-phenylpropan-2-yl)-5-propylpyrazole-4-carboxamide.
| Compound Name | ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-phenyl-N-(2-phenylpropan-2-yl)-5-propylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 143069826 |
| Molecular Formula | C31H39N3O |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | ethane;3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1-phenyl-N-(2-phenylpropan-2-yl)-5-propylpyrazole-4-carboxamide |
| SMILES | C=C/C=C\C(=C/C)c1nn(-c2ccccc2)c(CCC)c1C(=O)NC(C)(C)c1ccccc1.CC |
| InChI | InChI=1S/C29H33N3O.C2H6/c1-6-9-17-22(8-3)27-26(28(33)30-29(4,5)23-18-12-10-13-19-23)25(16-7-2)32(31-27)24-20-14-11-15-21-24;1-2/h6,8-15,17-21H,1,7,16H2,2-5H3,(H,30,33);1-2H3/b17-9-,22-8+; |
| InChIKey | JIXTVGHJDBGHAU-UIEUJKAHSA-N |
| XLogP | 7.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|