C32H31N3O — CID 143069557
N-(1,1-diphenylethyl)-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-methyl-1-phenylpyrazole-4-carboxamide (PubChem CID 143069557) has the molecular formula C32H31N3O and a molecular weight of 473.62 g/mol. Its IUPAC name is N-(1,1-diphenylethyl)-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-methyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-(1,1-diphenylethyl)-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-methyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 143069557 |
| Molecular Formula | C32H31N3O |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-(1,1-diphenylethyl)-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-5-methyl-1-phenylpyrazole-4-carboxamide |
| SMILES | C=C/C=C\C(=C/C)c1nn(-c2ccccc2)c(C)c1C(=O)NC(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H31N3O/c1-5-7-17-25(6-2)30-29(24(3)35(34-30)28-22-15-10-16-23-28)31(36)33-32(4,26-18-11-8-12-19-26)27-20-13-9-14-21-27/h5-23H,1H2,2-4H3,(H,33,36)/b17-7-,25-6+ |
| InChIKey | BOOLTJWJJPLBRA-XZFHXGRJSA-N |
| XLogP | 7.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|