C19H20F2N2O — CID 143070202
4-[(5R)-9-(difluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]aniline (PubChem CID 143070202) has the molecular formula C19H20F2N2O and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[(5R)-9-(difluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]aniline.
| Compound Name | 4-[(5R)-9-(difluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]aniline |
|---|---|
| PubChem CID | 143070202 |
| Molecular Formula | C19H20F2N2O |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-[(5R)-9-(difluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]aniline |
| SMILES | Nc1ccc([C@@H]2Nc3ccc(C(F)F)cc3C3OCCCC32)cc1 |
| InChI | InChI=1S/C19H20F2N2O/c20-19(21)12-5-8-16-15(10-12)18-14(2-1-9-24-18)17(23-16)11-3-6-13(22)7-4-11/h3-8,10,14,17-19,23H,1-2,9,22H2/t14?,17-,18?/m0/s1 |
| InChIKey | MFBQCDYCFDILRN-GMXGEUMGSA-N |
| XLogP | 4.84 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|