C21H24FNO — CID 11393205
5-(3-fluorophenyl)-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 11393205) has the molecular formula C21H24FNO and a molecular weight of 325.43 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | 5-(3-fluorophenyl)-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 11393205 |
| Molecular Formula | C21H24FNO |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 5-(3-fluorophenyl)-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CC(C)c1ccc2c(c1)C1OCCCC1C(c1cccc(F)c1)N2 |
| InChI | InChI=1S/C21H24FNO/c1-13(2)14-8-9-19-18(12-14)21-17(7-4-10-24-21)20(23-19)15-5-3-6-16(22)11-15/h3,5-6,8-9,11-13,17,20-21,23H,4,7,10H2,1-2H3 |
| InChIKey | PTDFPEFJWKIUIL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |