C16H29ClN2O3 — CID 143070610
tert-butyl acetate;2-(chloromethyl)-5-heptan-4-yl-1,3,4-oxadiazole (PubChem CID 143070610) has the molecular formula C16H29ClN2O3 and a molecular weight of 332.87 g/mol. Its IUPAC name is tert-butyl acetate;2-(chloromethyl)-5-heptan-4-yl-1,3,4-oxadiazole.
| Compound Name | tert-butyl acetate;2-(chloromethyl)-5-heptan-4-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143070610 |
| Molecular Formula | C16H29ClN2O3 |
| Molecular Weight | 332.87 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | tert-butyl acetate;2-(chloromethyl)-5-heptan-4-yl-1,3,4-oxadiazole |
| SMILES | CC(=O)OC(C)(C)C.CCCC(CCC)c1nnc(CCl)o1 |
| InChI | InChI=1S/C10H17ClN2O.C6H12O2/c1-3-5-8(6-4-2)10-13-12-9(7-11)14-10;1-5(7)8-6(2,3)4/h8H,3-7H2,1-2H3;1-4H3 |
| InChIKey | VERFBICDUDIMST-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.87 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|