C27H34F2N2O2 — CID 143074214
(2,6-difluorophenyl)-(5-methoxy-7-methyl-1'-propylspiro[2H-indole-3,4'-azepane]-1-yl)methanone;ethene (PubChem CID 143074214) has the molecular formula C27H34F2N2O2 and a molecular weight of 456.58 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(5-methoxy-7-methyl-1'-propylspiro[2H-indole-3,4'-azepane]-1-yl)methanone;ethene.
| Compound Name | (2,6-difluorophenyl)-(5-methoxy-7-methyl-1'-propylspiro[2H-indole-3,4'-azepane]-1-yl)methanone;ethene |
|---|---|
| PubChem CID | 143074214 |
| Molecular Formula | C27H34F2N2O2 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | (2,6-difluorophenyl)-(5-methoxy-7-methyl-1'-propylspiro[2H-indole-3,4'-azepane]-1-yl)methanone;ethene |
| SMILES | C=C.CCCN1CCCC2(CC1)CN(C(=O)c1c(F)cccc1F)c1c(C)cc(OC)cc12 |
| InChI | InChI=1S/C25H30F2N2O2.C2H4/c1-4-11-28-12-6-9-25(10-13-28)16-29(23-17(2)14-18(31-3)15-19(23)25)24(30)22-20(26)7-5-8-21(22)27;1-2/h5,7-8,14-15H,4,6,9-13,16H2,1-3H3;1-2H2 |
| InChIKey | AQIDWTOGMSYCDM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|