C20H21FN2O3 — CID 143075888
[4-(4-cyano-3-fluorophenoxy)phenyl]methyl-(3-methylbutyl)carbamic acid (PubChem CID 143075888) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is [4-(4-cyano-3-fluorophenoxy)phenyl]methyl-(3-methylbutyl)carbamic acid.
| Compound Name | [4-(4-cyano-3-fluorophenoxy)phenyl]methyl-(3-methylbutyl)carbamic acid |
|---|---|
| PubChem CID | 143075888 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [4-(4-cyano-3-fluorophenoxy)phenyl]methyl-(3-methylbutyl)carbamic acid |
| SMILES | CC(C)CCN(Cc1ccc(Oc2ccc(C#N)c(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C20H21FN2O3/c1-14(2)9-10-23(20(24)25)13-15-3-6-17(7-4-15)26-18-8-5-16(12-22)19(21)11-18/h3-8,11,14H,9-10,13H2,1-2H3,(H,24,25) |
| InChIKey | RCLHCRSLRMWKQJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |