C15H21N3O2S — CID 143082784
(3S,6S)-6-(methylamino)-5-oxo-N-(thiophen-3-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizine-3-carboxamide (PubChem CID 143082784) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is (3S,6S)-6-(methylamino)-5-oxo-N-(thiophen-3-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizine-3-carboxamide.
| Compound Name | (3S,6S)-6-(methylamino)-5-oxo-N-(thiophen-3-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizine-3-carboxamide |
|---|---|
| PubChem CID | 143082784 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (3S,6S)-6-(methylamino)-5-oxo-N-(thiophen-3-ylmethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizine-3-carboxamide |
| SMILES | CN[C@H]1CCC2CC[C@@H](C(=O)NCc3ccsc3)N2C1=O |
| InChI | InChI=1S/C15H21N3O2S/c1-16-12-4-2-11-3-5-13(18(11)15(12)20)14(19)17-8-10-6-7-21-9-10/h6-7,9,11-13,16H,2-5,8H2,1H3,(H,17,19)/t11?,12-,13-/m0/s1 |
| InChIKey | CHIZAGFMQKCKBA-SPOOISQMSA-N |
| XLogP | 1.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |