C18H20N4O4 — CID 143084002
ethane;methyl 2-[5-[(4-nitrophenyl)methyl]imidazo[1,2-c]pyrimidin-8-yl]acetate (PubChem CID 143084002) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethane;methyl 2-[5-[(4-nitrophenyl)methyl]imidazo[1,2-c]pyrimidin-8-yl]acetate.
| Compound Name | ethane;methyl 2-[5-[(4-nitrophenyl)methyl]imidazo[1,2-c]pyrimidin-8-yl]acetate |
|---|---|
| PubChem CID | 143084002 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | ethane;methyl 2-[5-[(4-nitrophenyl)methyl]imidazo[1,2-c]pyrimidin-8-yl]acetate |
| SMILES | CC.COC(=O)Cc1cnc(Cc2ccc([N+](=O)[O-])cc2)n2ccnc12 |
| InChI | InChI=1S/C16H14N4O4.C2H6/c1-24-15(21)9-12-10-18-14(19-7-6-17-16(12)19)8-11-2-4-13(5-3-11)20(22)23;1-2/h2-7,10H,8-9H2,1H3;1-2H3 |
| InChIKey | MVULMOLBLCGSKQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|